C12H13FN4 — CID 80760868
5-ethyl-4-N-(2-fluorophenyl)pyrimidine-4,6-diamine (PubChem CID 80760868) has the molecular formula C12H13FN4 and a molecular weight of 232.26 g/mol. Its IUPAC name is 5-ethyl-4-N-(2-fluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 5-ethyl-4-N-(2-fluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80760868 |
| Molecular Formula | C12H13FN4 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 5-ethyl-4-N-(2-fluorophenyl)pyrimidine-4,6-diamine |
| SMILES | CCc1c(N)ncnc1Nc1ccccc1F |
| InChI | InChI=1S/C12H13FN4/c1-2-8-11(14)15-7-16-12(8)17-10-6-4-3-5-9(10)13/h3-7H,2H2,1H3,(H3,14,15,16,17) |
| InChIKey | QXJXDEMZLKDOFV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |