C7H12N4 — CID 80770928
5-ethyl-4-N-methylpyrimidine-4,6-diamine (PubChem CID 80770928) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-ethyl-4-N-methylpyrimidine-4,6-diamine.
| Compound Name | 5-ethyl-4-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80770928 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 5-ethyl-4-N-methylpyrimidine-4,6-diamine |
| SMILES | CCc1c(N)ncnc1NC |
| InChI | InChI=1S/C7H12N4/c1-3-5-6(8)10-4-11-7(5)9-2/h4H,3H2,1-2H3,(H3,8,9,10,11) |
| InChIKey | KMXUOQUDGYGINP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |