C9H16N4O2 — CID 80850758
3-[(6-amino-5-ethylpyrimidin-4-yl)amino]propane-1,2-diol (PubChem CID 80850758) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]propane-1,2-diol.
| Compound Name | 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 80850758 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-[(6-amino-5-ethylpyrimidin-4-yl)amino]propane-1,2-diol |
| SMILES | CCc1c(N)ncnc1NCC(O)CO |
| InChI | InChI=1S/C9H16N4O2/c1-2-7-8(10)12-5-13-9(7)11-3-6(15)4-14/h5-6,14-15H,2-4H2,1H3,(H3,10,11,12,13) |
| InChIKey | ZPYPJHCNUNQOQZ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |