C12H22N4 — CID 80803162
5-ethyl-4-N-(3-methylpentan-2-yl)pyrimidine-4,6-diamine (PubChem CID 80803162) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 5-ethyl-4-N-(3-methylpentan-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-ethyl-4-N-(3-methylpentan-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80803162 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 5-ethyl-4-N-(3-methylpentan-2-yl)pyrimidine-4,6-diamine |
| SMILES | CCc1c(N)ncnc1NC(C)C(C)CC |
| InChI | InChI=1S/C12H22N4/c1-5-8(3)9(4)16-12-10(6-2)11(13)14-7-15-12/h7-9H,5-6H2,1-4H3,(H3,13,14,15,16) |
| InChIKey | NIMXDFZGNTXBLE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |