C13H25N5 — CID 114139951
5-ethyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]pyrimidine-4,6-diamine (PubChem CID 114139951) has the molecular formula C13H25N5 and a molecular weight of 251.38 g/mol. Its IUPAC name is 5-ethyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]pyrimidine-4,6-diamine.
| Compound Name | 5-ethyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 114139951 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 5-ethyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]pyrimidine-4,6-diamine |
| SMILES | CCc1c(N)ncnc1NCCCN(C)C(C)C |
| InChI | InChI=1S/C13H25N5/c1-5-11-12(14)16-9-17-13(11)15-7-6-8-18(4)10(2)3/h9-10H,5-8H2,1-4H3,(H3,14,15,16,17) |
| InChIKey | OXSXWKYUBOCWNB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|