C13H24N6O2 — CID 106042282
6-N-ethyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 106042282) has the molecular formula C13H24N6O2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 6-N-ethyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-ethyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106042282 |
| Molecular Formula | C13H24N6O2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 6-N-ethyl-4-N-[3-[methyl(propan-2-yl)amino]propyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | CCNc1ncnc(NCCCN(C)C(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H24N6O2/c1-5-14-12-11(19(20)21)13(17-9-16-12)15-7-6-8-18(4)10(2)3/h9-10H,5-8H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | GKRMKRYNEBNLFD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|