C11H8Cl2FIN4 — CID 114261764
3,5-dichloro-N-(3-fluoro-2-iodophenyl)-6-hydrazinylpyridin-2-amine (PubChem CID 114261764) has the molecular formula C11H8Cl2FIN4 and a molecular weight of 413.02 g/mol. Its IUPAC name is 3,5-dichloro-N-(3-fluoro-2-iodophenyl)-6-hydrazinylpyridin-2-amine.
| Compound Name | 3,5-dichloro-N-(3-fluoro-2-iodophenyl)-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 114261764 |
| Molecular Formula | C11H8Cl2FIN4 |
| Molecular Weight | 413.02 g/mol |
| Exact Mass | 411.92 |
| IUPAC Name | 3,5-dichloro-N-(3-fluoro-2-iodophenyl)-6-hydrazinylpyridin-2-amine |
| SMILES | NNc1nc(Nc2cccc(F)c2I)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H8Cl2FIN4/c12-5-4-6(13)11(19-16)18-10(5)17-8-3-1-2-7(14)9(8)15/h1-4H,16H2,(H2,17,18,19) |
| InChIKey | GDWHAOLXIVLIDG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.02 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|