C10H8ClFIN5 — CID 114261691
6-chloro-2-N-(3-fluoro-2-iodophenyl)-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 114261691) has the molecular formula C10H8ClFIN5 and a molecular weight of 379.56 g/mol. Its IUPAC name is 6-chloro-2-N-(3-fluoro-2-iodophenyl)-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(3-fluoro-2-iodophenyl)-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 114261691 |
| Molecular Formula | C10H8ClFIN5 |
| Molecular Weight | 379.56 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 6-chloro-2-N-(3-fluoro-2-iodophenyl)-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Cl)nc(Nc2cccc(F)c2I)n1 |
| InChI | InChI=1S/C10H8ClFIN5/c1-14-9-16-8(11)17-10(18-9)15-6-4-2-3-5(12)7(6)13/h2-4H,1H3,(H2,14,15,16,17,18) |
| InChIKey | NLUHSHDJDXWZHG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|