C10H5ClF5N5 — CID 115565288
6-chloro-4-N-methyl-2-N-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 115565288) has the molecular formula C10H5ClF5N5 and a molecular weight of 325.63 g/mol. Its IUPAC name is 6-chloro-4-N-methyl-2-N-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-methyl-2-N-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 115565288 |
| Molecular Formula | C10H5ClF5N5 |
| Molecular Weight | 325.63 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 6-chloro-4-N-methyl-2-N-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Cl)nc(Nc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C10H5ClF5N5/c1-17-9-19-8(11)20-10(21-9)18-7-5(15)3(13)2(12)4(14)6(7)16/h1H3,(H2,17,18,19,20,21) |
| InChIKey | SKVOFJHYEUSPML-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.63 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|