C4H6Cl2N6 — CID 154732087
2-N,4-N-dichloro-6-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 154732087) has the molecular formula C4H6Cl2N6 and a molecular weight of 209.04 g/mol. Its IUPAC name is 2-N,4-N-dichloro-6-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-dichloro-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 154732087 |
| Molecular Formula | C4H6Cl2N6 |
| Molecular Weight | 209.04 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 2-N,4-N-dichloro-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCl)nc(NCl)n1 |
| InChI | InChI=1S/C4H6Cl2N6/c1-7-2-8-3(11-5)10-4(9-2)12-6/h1H3,(H3,7,8,9,10,11,12) |
| InChIKey | GQHVSVPHTIHXIQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.04 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|