C6H19N6O3+ — CID 174669762
hydron;2-N,4-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine;trihydrate (PubChem CID 174669762) has the molecular formula C6H19N6O3+ and a molecular weight of 223.26 g/mol. Its IUPAC name is hydron;2-N,4-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine;trihydrate.
| Compound Name | hydron;2-N,4-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine;trihydrate |
|---|---|
| PubChem CID | 174669762 |
| Molecular Formula | C6H19N6O3+ |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | hydron;2-N,4-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine;trihydrate |
| SMILES | CNc1nc(NC)nc(NC)n1.O.O.O.[H+] |
| InChI | InChI=1S/C6H12N6.3H2O/c1-7-4-10-5(8-2)12-6(9-3)11-4;;;/h1-3H3,(H3,7,8,9,10,11,12);3*1H2/p+1 |
| InChIKey | PICLGTWFLVDPOS-UHFFFAOYSA-O |
| XLogP | -2.36 |
| TPSA | 169.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |