C5H8ClN5O — CID 119092780
6-chloro-2-N-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 119092780) has the molecular formula C5H8ClN5O and a molecular weight of 189.61 g/mol. Its IUPAC name is 6-chloro-2-N-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 119092780 |
| Molecular Formula | C5H8ClN5O |
| Molecular Weight | 189.61 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 6-chloro-2-N-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Cl)nc(NOC)n1 |
| InChI | InChI=1S/C5H8ClN5O/c1-7-4-8-3(6)9-5(10-4)11-12-2/h1-2H3,(H2,7,8,9,10,11) |
| InChIKey | FOUIYEDWNPVLOW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.61 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|