C11H10ClN5O2 — CID 174351013
phenyl N-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]carbamate (PubChem CID 174351013) has the molecular formula C11H10ClN5O2 and a molecular weight of 279.69 g/mol. Its IUPAC name is phenyl N-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]carbamate.
| Compound Name | phenyl N-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]carbamate |
|---|---|
| PubChem CID | 174351013 |
| Molecular Formula | C11H10ClN5O2 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | phenyl N-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]carbamate |
| SMILES | CNc1nc(Cl)nc(NC(=O)Oc2ccccc2)n1 |
| InChI | InChI=1S/C11H10ClN5O2/c1-13-9-14-8(12)15-10(16-9)17-11(18)19-7-5-3-2-4-6-7/h2-6H,1H3,(H2,13,14,15,16,17,18) |
| InChIKey | DCRKRKNWLABEBB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |