C19H18Cl2N4O2 — CID 167580490
6-chloro-5-methylpyridin-2-amine;phenyl N-(6-chloro-5-methyl-2-pyridinyl)carbamate (PubChem CID 167580490) has the molecular formula C19H18Cl2N4O2 and a molecular weight of 405.29 g/mol. Its IUPAC name is 6-chloro-5-methylpyridin-2-amine;phenyl N-(6-chloro-5-methyl-2-pyridinyl)carbamate.
| Compound Name | 6-chloro-5-methylpyridin-2-amine;phenyl N-(6-chloro-5-methyl-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 167580490 |
| Molecular Formula | C19H18Cl2N4O2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 6-chloro-5-methylpyridin-2-amine;phenyl N-(6-chloro-5-methyl-2-pyridinyl)carbamate |
| SMILES | Cc1ccc(N)nc1Cl.Cc1ccc(NC(=O)Oc2ccccc2)nc1Cl |
| InChI | InChI=1S/C13H11ClN2O2.C6H7ClN2/c1-9-7-8-11(15-12(9)14)16-13(17)18-10-5-3-2-4-6-10;1-4-2-3-5(8)9-6(4)7/h2-8H,1H3,(H,15,16,17);2-3H,1H3,(H2,8,9) |
| InChIKey | HCQRUMQCOCQBRC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|