C16H13NO6 — CID 67543732
4-methyl-5-(phenoxycarbonylamino)phthalic acid (PubChem CID 67543732) has the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. Its IUPAC name is 4-methyl-5-(phenoxycarbonylamino)phthalic acid.
| Compound Name | 4-methyl-5-(phenoxycarbonylamino)phthalic acid |
|---|---|
| PubChem CID | 67543732 |
| Molecular Formula | C16H13NO6 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-methyl-5-(phenoxycarbonylamino)phthalic acid |
| SMILES | Cc1cc(C(=O)O)c(C(=O)O)cc1NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H13NO6/c1-9-7-11(14(18)19)12(15(20)21)8-13(9)17-16(22)23-10-5-3-2-4-6-10/h2-8H,1H3,(H,17,22)(H,18,19)(H,20,21) |
| InChIKey | DIHHKPHSUACXGD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |