C16H13NO7 — CID 18974701
5-[(2-carboxyphenyl)carbamoyloxy]-2-methoxybenzoic acid (PubChem CID 18974701) has the molecular formula C16H13NO7 and a molecular weight of 331.28 g/mol. Its IUPAC name is 5-[(2-carboxyphenyl)carbamoyloxy]-2-methoxybenzoic acid.
| Compound Name | 5-[(2-carboxyphenyl)carbamoyloxy]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 18974701 |
| Molecular Formula | C16H13NO7 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 5-[(2-carboxyphenyl)carbamoyloxy]-2-methoxybenzoic acid |
| SMILES | COc1ccc(OC(=O)Nc2ccccc2C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C16H13NO7/c1-23-13-7-6-9(8-11(13)15(20)21)24-16(22)17-12-5-3-2-4-10(12)14(18)19/h2-8H,1H3,(H,17,22)(H,18,19)(H,20,21) |
| InChIKey | XICCILOKCGAWEV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |