C15H13FN2O4 — CID 66804164
phenyl N-[5-(fluorooxycarbonylamino)-2-methylphenyl]carbamate (PubChem CID 66804164) has the molecular formula C15H13FN2O4 and a molecular weight of 304.28 g/mol. Its IUPAC name is phenyl N-[5-(fluorooxycarbonylamino)-2-methylphenyl]carbamate.
| Compound Name | phenyl N-[5-(fluorooxycarbonylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 66804164 |
| Molecular Formula | C15H13FN2O4 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | phenyl N-[5-(fluorooxycarbonylamino)-2-methylphenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)OF)cc1NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C15H13FN2O4/c1-10-7-8-11(17-15(20)22-16)9-13(10)18-14(19)21-12-5-3-2-4-6-12/h2-9H,1H3,(H,17,20)(H,18,19) |
| InChIKey | CCGQBIJATMRQES-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |