C37H36N4O4 — CID 15180712
(dibenzylamino) N-[3-[(dibenzylamino)oxycarbonylamino]-4-methylphenyl]carbamate (PubChem CID 15180712) has the molecular formula C37H36N4O4 and a molecular weight of 600.72 g/mol. Its IUPAC name is (dibenzylamino) N-[3-[(dibenzylamino)oxycarbonylamino]-4-methylphenyl]carbamate.
| Compound Name | (dibenzylamino) N-[3-[(dibenzylamino)oxycarbonylamino]-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 15180712 |
| Molecular Formula | C37H36N4O4 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | (dibenzylamino) N-[3-[(dibenzylamino)oxycarbonylamino]-4-methylphenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)ON(Cc2ccccc2)Cc2ccccc2)cc1NC(=O)ON(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H36N4O4/c1-29-22-23-34(38-36(42)44-40(25-30-14-6-2-7-15-30)26-31-16-8-3-9-17-31)24-35(29)39-37(43)45-41(27-32-18-10-4-11-19-32)28-33-20-12-5-13-21-33/h2-24H,25-28H2,1H3,(H,38,42)(H,39,43) |
| InChIKey | IHDHSPSIRBVISC-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|