C13H16N8O4 — CID 90222016
2-azidoethyl N-[3-(2-azidoethoxycarbonylamino)-4-methylphenyl]carbamate (PubChem CID 90222016) has the molecular formula C13H16N8O4 and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-azidoethyl N-[3-(2-azidoethoxycarbonylamino)-4-methylphenyl]carbamate.
| Compound Name | 2-azidoethyl N-[3-(2-azidoethoxycarbonylamino)-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 90222016 |
| Molecular Formula | C13H16N8O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-azidoethyl N-[3-(2-azidoethoxycarbonylamino)-4-methylphenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)OCCN=[N+]=[N-])cc1NC(=O)OCCN=[N+]=[N-] |
| InChI | InChI=1S/C13H16N8O4/c1-9-2-3-10(18-12(22)24-6-4-16-20-14)8-11(9)19-13(23)25-7-5-17-21-15/h2-3,8H,4-7H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | IQQRUMRMSGJHFC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 174.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|