C21H30N4O6 — CID 162110365
methyl acetate;4-methylbenzene-1,3-diamine;methyl N-[3-(methoxycarbonylamino)-4-methylphenyl]carbamate (PubChem CID 162110365) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is methyl acetate;4-methylbenzene-1,3-diamine;methyl N-[3-(methoxycarbonylamino)-4-methylphenyl]carbamate.
| Compound Name | methyl acetate;4-methylbenzene-1,3-diamine;methyl N-[3-(methoxycarbonylamino)-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 162110365 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | methyl acetate;4-methylbenzene-1,3-diamine;methyl N-[3-(methoxycarbonylamino)-4-methylphenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(C)c(NC(=O)OC)c1.COC(C)=O.Cc1ccc(N)cc1N |
| InChI | InChI=1S/C11H14N2O4.C7H10N2.C3H6O2/c1-7-4-5-8(12-10(14)16-2)6-9(7)13-11(15)17-3;1-5-2-3-6(8)4-7(5)9;1-3(4)5-2/h4-6H,1-3H3,(H,12,14)(H,13,15);2-4H,8-9H2,1H3;1-2H3 |
| InChIKey | ZGBNMAJLDOPVOU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|