C13H17N3O6 — CID 149435265
methyl N-[3,5-bis(methoxycarbonylamino)-2-methylphenyl]carbamate (PubChem CID 149435265) has the molecular formula C13H17N3O6 and a molecular weight of 311.29 g/mol. Its IUPAC name is methyl N-[3,5-bis(methoxycarbonylamino)-2-methylphenyl]carbamate.
| Compound Name | methyl N-[3,5-bis(methoxycarbonylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 149435265 |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | methyl N-[3,5-bis(methoxycarbonylamino)-2-methylphenyl]carbamate |
| SMILES | COC(=O)Nc1cc(NC(=O)OC)c(C)c(NC(=O)OC)c1 |
| InChI | InChI=1S/C13H17N3O6/c1-7-9(15-12(18)21-3)5-8(14-11(17)20-2)6-10(7)16-13(19)22-4/h5-6H,1-4H3,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | ZQKQRYXEVOEHED-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|