C22H22N4O4 — CID 23026427
methyl N-[2,4-dianilino-5-(methoxycarbonylamino)phenyl]carbamate (PubChem CID 23026427) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is methyl N-[2,4-dianilino-5-(methoxycarbonylamino)phenyl]carbamate.
| Compound Name | methyl N-[2,4-dianilino-5-(methoxycarbonylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 23026427 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | methyl N-[2,4-dianilino-5-(methoxycarbonylamino)phenyl]carbamate |
| SMILES | COC(=O)Nc1cc(NC(=O)OC)c(Nc2ccccc2)cc1Nc1ccccc1 |
| InChI | InChI=1S/C22H22N4O4/c1-29-21(27)25-19-14-20(26-22(28)30-2)18(24-16-11-7-4-8-12-16)13-17(19)23-15-9-5-3-6-10-15/h3-14,23-24H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | FRIPQNLRNMDQGH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |