C12H17N3O4 — CID 21482981
propan-2-yl N-[3-amino-4-(methoxycarbonylamino)phenyl]carbamate (PubChem CID 21482981) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is propan-2-yl N-[3-amino-4-(methoxycarbonylamino)phenyl]carbamate.
| Compound Name | propan-2-yl N-[3-amino-4-(methoxycarbonylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 21482981 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | propan-2-yl N-[3-amino-4-(methoxycarbonylamino)phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NC(=O)OC(C)C)cc1N |
| InChI | InChI=1S/C12H17N3O4/c1-7(2)19-12(17)14-8-4-5-10(9(13)6-8)15-11(16)18-3/h4-7H,13H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | MZMDILZUAGSBTD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|