C15H20N4O5S — CID 21483073
propan-2-yl N-[4-acetamido-3-(methoxycarbonylcarbamothioylamino)phenyl]carbamate (PubChem CID 21483073) has the molecular formula C15H20N4O5S and a molecular weight of 368.42 g/mol. Its IUPAC name is propan-2-yl N-[4-acetamido-3-(methoxycarbonylcarbamothioylamino)phenyl]carbamate.
| Compound Name | propan-2-yl N-[4-acetamido-3-(methoxycarbonylcarbamothioylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 21483073 |
| Molecular Formula | C15H20N4O5S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | propan-2-yl N-[4-acetamido-3-(methoxycarbonylcarbamothioylamino)phenyl]carbamate |
| SMILES | COC(=O)NC(=S)Nc1cc(NC(=O)OC(C)C)ccc1NC(C)=O |
| InChI | InChI=1S/C15H20N4O5S/c1-8(2)24-15(22)17-10-5-6-11(16-9(3)20)12(7-10)18-13(25)19-14(21)23-4/h5-8H,1-4H3,(H,16,20)(H,17,22)(H2,18,19,21,25) |
| InChIKey | URRPZNCNWZZBLQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|