About methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine
methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine (PubChem CID 139194452) has the molecular formula C17H19N5O4S2
and a molecular weight of 421.50 g/mol. Its IUPAC name is methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine.
Molecular Properties
| Compound Name | methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine |
| PubChem CID | 139194452 |
| Molecular Formula | C17H19N5O4S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine |
| SMILES | COC(=O)NC(=S)Nc1ccccc1NC(=S)NC(=O)OC.c1ccncc1 |
| InChI | InChI=1S/C12H14N4O4S2.C5H5N/c1-19-11(17)15-9(21)13-7-5-3-4-6-8(7)14-10(22)16-12(18)20-2;1-2-4-6-5-3-1/h3-6H,1-2H3,(H2,13,15,17,21)(H2,14,16,18,22);1-5H |
| InChIKey | RWWKJKRCIVPTEQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine?
The IUPAC name of methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine (CID 139194452) is methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine.
What is the SMILES notation for methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine?
The canonical SMILES for methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine is COC(=O)NC(=S)Nc1ccccc1NC(=S)NC(=O)OC.c1ccncc1.
What is the InChIKey of methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine?
The InChIKey is RWWKJKRCIVPTEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O4S2.C5H5N/c1-19-11(17)15-9(21)13-7-5-3-4-6-8(7)14-10(22)16-12(18)20-2;1-2-4-6-5-3-1/h3-6H,1-2H3,(H2,13,15,17,21)(H2,14,16,18,22);1-5H.
What are the key properties of methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine?
methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine has a molecular weight of 421.50 g/mol, XLogP of 2.87, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine is sourced from PubChem (CID 139194452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).