C17H19N5O4S2 — CID 139194452
methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine (PubChem CID 139194452) has the molecular formula C17H19N5O4S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine.
| Compound Name | methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine |
|---|---|
| PubChem CID | 139194452 |
| Molecular Formula | C17H19N5O4S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;pyridine |
| SMILES | COC(=O)NC(=S)Nc1ccccc1NC(=S)NC(=O)OC.c1ccncc1 |
| InChI | InChI=1S/C12H14N4O4S2.C5H5N/c1-19-11(17)15-9(21)13-7-5-3-4-6-8(7)14-10(22)16-12(18)20-2;1-2-4-6-5-3-1/h3-6H,1-2H3,(H2,13,15,17,21)(H2,14,16,18,22);1-5H |
| InChIKey | RWWKJKRCIVPTEQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|