C15H13N3O6S2 — CID 154237452
methyl N-[[4-(benzenesulfonyl)-2-nitrophenyl]carbamothioyl]carbamate (PubChem CID 154237452) has the molecular formula C15H13N3O6S2 and a molecular weight of 395.42 g/mol. Its IUPAC name is methyl N-[[4-(benzenesulfonyl)-2-nitrophenyl]carbamothioyl]carbamate.
| Compound Name | methyl N-[[4-(benzenesulfonyl)-2-nitrophenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 154237452 |
| Molecular Formula | C15H13N3O6S2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | methyl N-[[4-(benzenesulfonyl)-2-nitrophenyl]carbamothioyl]carbamate |
| SMILES | COC(=O)NC(=S)Nc1ccc(S(=O)(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O6S2/c1-24-15(19)17-14(25)16-12-8-7-11(9-13(12)18(20)21)26(22,23)10-5-3-2-4-6-10/h2-9H,1H3,(H2,16,17,19,25) |
| InChIKey | WBPRPPMVJXJHSC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|