C23H18N4O5S — CID 88784351
methyl N-[[4-benzoyl-2-(2-nitrobenzenecarboximidoyl)phenyl]carbamothioyl]carbamate (PubChem CID 88784351) has the molecular formula C23H18N4O5S and a molecular weight of 462.49 g/mol. Its IUPAC name is methyl N-[[4-benzoyl-2-(2-nitrobenzenecarboximidoyl)phenyl]carbamothioyl]carbamate.
| Compound Name | methyl N-[[4-benzoyl-2-(2-nitrobenzenecarboximidoyl)phenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 88784351 |
| Molecular Formula | C23H18N4O5S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | methyl N-[[4-benzoyl-2-(2-nitrobenzenecarboximidoyl)phenyl]carbamothioyl]carbamate |
| SMILES | [H]/N=C(\c1cc(C(=O)c2ccccc2)ccc1NC(=S)NC(=O)OC)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H18N4O5S/c1-32-23(29)26-22(33)25-18-12-11-15(21(28)14-7-3-2-4-8-14)13-17(18)20(24)16-9-5-6-10-19(16)27(30)31/h2-13,24H,1H3,(H2,25,26,29,33)/b24-20- |
| InChIKey | UBEKVWYWILMMRQ-GFMRDNFCSA-N |
| XLogP | 4.29 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|