C16H15N3O3S — CID 3036972
methyl N-[(2-amino-5-benzoylphenyl)carbamothioyl]carbamate (PubChem CID 3036972) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is methyl N-[(2-amino-5-benzoylphenyl)carbamothioyl]carbamate.
| Compound Name | methyl N-[(2-amino-5-benzoylphenyl)carbamothioyl]carbamate |
|---|---|
| PubChem CID | 3036972 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | methyl N-[(2-amino-5-benzoylphenyl)carbamothioyl]carbamate |
| SMILES | COC(=O)NC(=S)Nc1cc(C(=O)c2ccccc2)ccc1N |
| InChI | InChI=1S/C16H15N3O3S/c1-22-16(21)19-15(23)18-13-9-11(7-8-12(13)17)14(20)10-5-3-2-4-6-10/h2-9H,17H2,1H3,(H2,18,19,21,23) |
| InChIKey | SOVIIRRAYRVPQE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|