C20H20N4O4S2 — CID 57151450
methyl N-[[2-(methoxycarbonylcarbamothioylamino)-4-(2-phenylethenyl)phenyl]carbamothioyl]carbamate (PubChem CID 57151450) has the molecular formula C20H20N4O4S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is methyl N-[[2-(methoxycarbonylcarbamothioylamino)-4-(2-phenylethenyl)phenyl]carbamothioyl]carbamate.
| Compound Name | methyl N-[[2-(methoxycarbonylcarbamothioylamino)-4-(2-phenylethenyl)phenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 57151450 |
| Molecular Formula | C20H20N4O4S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | methyl N-[[2-(methoxycarbonylcarbamothioylamino)-4-(2-phenylethenyl)phenyl]carbamothioyl]carbamate |
| SMILES | COC(=O)NC(=S)Nc1ccc(C=Cc2ccccc2)cc1NC(=S)NC(=O)OC |
| InChI | InChI=1S/C20H20N4O4S2/c1-27-19(25)23-17(29)21-15-11-10-14(9-8-13-6-4-3-5-7-13)12-16(15)22-18(30)24-20(26)28-2/h3-12H,1-2H3,(H2,21,23,25,29)(H2,22,24,26,30) |
| InChIKey | ULFRHOSHRHAJNB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|