C20H20ClN3O4S — CID 13023189
methyl N-[[5-benzoyl-2-(4-chlorobutanoylamino)phenyl]carbamothioyl]carbamate (PubChem CID 13023189) has the molecular formula C20H20ClN3O4S and a molecular weight of 433.92 g/mol. Its IUPAC name is methyl N-[[5-benzoyl-2-(4-chlorobutanoylamino)phenyl]carbamothioyl]carbamate.
| Compound Name | methyl N-[[5-benzoyl-2-(4-chlorobutanoylamino)phenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 13023189 |
| Molecular Formula | C20H20ClN3O4S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | methyl N-[[5-benzoyl-2-(4-chlorobutanoylamino)phenyl]carbamothioyl]carbamate |
| SMILES | COC(=O)NC(=S)Nc1cc(C(=O)c2ccccc2)ccc1NC(=O)CCCCl |
| InChI | InChI=1S/C20H20ClN3O4S/c1-28-20(27)24-19(29)23-16-12-14(18(26)13-6-3-2-4-7-13)9-10-15(16)22-17(25)8-5-11-21/h2-4,6-7,9-10,12H,5,8,11H2,1H3,(H,22,25)(H2,23,24,27,29) |
| InChIKey | IGFAWNADDFCMSM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|