C21H25N3O3S2 — CID 21438488
methyl N-[[2-(hexanoylamino)-4-phenylsulfanylphenyl]carbamothioyl]carbamate (PubChem CID 21438488) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is methyl N-[[2-(hexanoylamino)-4-phenylsulfanylphenyl]carbamothioyl]carbamate.
| Compound Name | methyl N-[[2-(hexanoylamino)-4-phenylsulfanylphenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 21438488 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | methyl N-[[2-(hexanoylamino)-4-phenylsulfanylphenyl]carbamothioyl]carbamate |
| SMILES | CCCCCC(=O)Nc1cc(Sc2ccccc2)ccc1NC(=S)NC(=O)OC |
| InChI | InChI=1S/C21H25N3O3S2/c1-3-4-6-11-19(25)22-18-14-16(29-15-9-7-5-8-10-15)12-13-17(18)23-20(28)24-21(26)27-2/h5,7-10,12-14H,3-4,6,11H2,1-2H3,(H,22,25)(H2,23,24,26,28) |
| InChIKey | JUGQKGMTXGVDCV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|