C12H13FN4O4S2 — CID 21412487
methyl N-[[4-fluoro-2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate (PubChem CID 21412487) has the molecular formula C12H13FN4O4S2 and a molecular weight of 360.39 g/mol. Its IUPAC name is methyl N-[[4-fluoro-2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate.
| Compound Name | methyl N-[[4-fluoro-2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 21412487 |
| Molecular Formula | C12H13FN4O4S2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | methyl N-[[4-fluoro-2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate |
| SMILES | COC(=O)NC(=S)Nc1ccc(F)cc1NC(=S)NC(=O)OC |
| InChI | InChI=1S/C12H13FN4O4S2/c1-20-11(18)16-9(22)14-7-4-3-6(13)5-8(7)15-10(23)17-12(19)21-2/h3-5H,1-2H3,(H2,14,16,18,22)(H2,15,17,19,23) |
| InChIKey | BMMZFFYNTQXFSY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|