C18H26N6O6S4 — CID 6452783
S-(dimethylcarbamoylsulfanyl) N,N-dimethylcarbamothioate;methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate (PubChem CID 6452783) has the molecular formula C18H26N6O6S4 and a molecular weight of 550.71 g/mol. Its IUPAC name is S-(dimethylcarbamoylsulfanyl) N,N-dimethylcarbamothioate;methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate.
| Compound Name | S-(dimethylcarbamoylsulfanyl) N,N-dimethylcarbamothioate;methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 6452783 |
| Molecular Formula | C18H26N6O6S4 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | S-(dimethylcarbamoylsulfanyl) N,N-dimethylcarbamothioate;methyl N-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate |
| SMILES | CN(C)C(=O)SSC(=O)N(C)C.COC(=O)NC(=S)Nc1ccccc1NC(=S)NC(=O)OC |
| InChI | InChI=1S/C12H14N4O4S2.C6H12N2O2S2/c1-19-11(17)15-9(21)13-7-5-3-4-6-8(7)14-10(22)16-12(18)20-2;1-7(2)5(9)11-12-6(10)8(3)4/h3-6H,1-2H3,(H2,13,15,17,21)(H2,14,16,18,22);1-4H3 |
| InChIKey | WQLUOXFADPZIRD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|