C16H19N3O5S2 — CID 21483077
methyl N-[(2-aminophenyl)carbamothioyl]carbamate;4-methylbenzenesulfonic acid (PubChem CID 21483077) has the molecular formula C16H19N3O5S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is methyl N-[(2-aminophenyl)carbamothioyl]carbamate;4-methylbenzenesulfonic acid.
| Compound Name | methyl N-[(2-aminophenyl)carbamothioyl]carbamate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 21483077 |
| Molecular Formula | C16H19N3O5S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | methyl N-[(2-aminophenyl)carbamothioyl]carbamate;4-methylbenzenesulfonic acid |
| SMILES | COC(=O)NC(=S)Nc1ccccc1N.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H11N3O2S.C7H8O3S/c1-14-9(13)12-8(15)11-7-5-3-2-4-6(7)10;1-6-2-4-7(5-3-6)11(8,9)10/h2-5H,10H2,1H3,(H2,11,12,13,15);2-5H,1H3,(H,8,9,10) |
| InChIKey | OYYCENOTIWUOJL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|