C11H13N3O2S3 — CID 54478418
methyl N-[[2-(methylsulfanylcarbothioylamino)phenyl]carbamothioyl]carbamate (PubChem CID 54478418) has the molecular formula C11H13N3O2S3 and a molecular weight of 315.45 g/mol. Its IUPAC name is methyl N-[[2-(methylsulfanylcarbothioylamino)phenyl]carbamothioyl]carbamate.
| Compound Name | methyl N-[[2-(methylsulfanylcarbothioylamino)phenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 54478418 |
| Molecular Formula | C11H13N3O2S3 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | methyl N-[[2-(methylsulfanylcarbothioylamino)phenyl]carbamothioyl]carbamate |
| SMILES | COC(=O)NC(=S)Nc1ccccc1NC(=S)SC |
| InChI | InChI=1S/C11H13N3O2S3/c1-16-10(15)14-9(17)12-7-5-3-4-6-8(7)13-11(18)19-2/h3-6H,1-2H3,(H,13,18)(H2,12,14,15,17) |
| InChIKey | XNGFYUOLCSMZQY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|