C12H15N3S3 — CID 71732423
N-[3,4-bis(ethanethioylamino)phenyl]ethanethioamide (PubChem CID 71732423) has the molecular formula C12H15N3S3 and a molecular weight of 297.47 g/mol. Its IUPAC name is N-[3,4-bis(ethanethioylamino)phenyl]ethanethioamide.
| Compound Name | N-[3,4-bis(ethanethioylamino)phenyl]ethanethioamide |
|---|---|
| PubChem CID | 71732423 |
| Molecular Formula | C12H15N3S3 |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[3,4-bis(ethanethioylamino)phenyl]ethanethioamide |
| SMILES | CC(=S)Nc1ccc(NC(C)=S)c(NC(C)=S)c1 |
| InChI | InChI=1S/C12H15N3S3/c1-7(16)13-10-4-5-11(14-8(2)17)12(6-10)15-9(3)18/h4-6H,1-3H3,(H,13,16)(H,14,17)(H,15,18) |
| InChIKey | FJJDLNDSWRJVOV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|