C8H11NO6P2S — CID 22955637
[4-(ethanethioylamino)-2-phosphonophenyl]phosphonic acid (PubChem CID 22955637) has the molecular formula C8H11NO6P2S and a molecular weight of 311.19 g/mol. Its IUPAC name is [4-(ethanethioylamino)-2-phosphonophenyl]phosphonic acid.
| Compound Name | [4-(ethanethioylamino)-2-phosphonophenyl]phosphonic acid |
|---|---|
| PubChem CID | 22955637 |
| Molecular Formula | C8H11NO6P2S |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | [4-(ethanethioylamino)-2-phosphonophenyl]phosphonic acid |
| SMILES | CC(=S)Nc1ccc(P(=O)(O)O)c(P(=O)(O)O)c1 |
| InChI | InChI=1S/C8H11NO6P2S/c1-5(18)9-6-2-3-7(16(10,11)12)8(4-6)17(13,14)15/h2-4H,1H3,(H,9,18)(H2,10,11,12)(H2,13,14,15) |
| InChIKey | ARYBNBVDEHHCNY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|