C19H25N3O4 — CID 163530490
4-methylbenzene-1,3-diamine;methyl 2-[5-(methoxycarbonylamino)-2-methylphenyl]acetate (PubChem CID 163530490) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-methylbenzene-1,3-diamine;methyl 2-[5-(methoxycarbonylamino)-2-methylphenyl]acetate.
| Compound Name | 4-methylbenzene-1,3-diamine;methyl 2-[5-(methoxycarbonylamino)-2-methylphenyl]acetate |
|---|---|
| PubChem CID | 163530490 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-methylbenzene-1,3-diamine;methyl 2-[5-(methoxycarbonylamino)-2-methylphenyl]acetate |
| SMILES | COC(=O)Cc1cc(NC(=O)OC)ccc1C.Cc1ccc(N)cc1N |
| InChI | InChI=1S/C12H15NO4.C7H10N2/c1-8-4-5-10(13-12(15)17-3)6-9(8)7-11(14)16-2;1-5-2-3-6(8)4-7(5)9/h4-6H,7H2,1-3H3,(H,13,15);2-4H,8-9H2,1H3 |
| InChIKey | DSOATLKMOLAWFC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|