C18H24N2O4 — CID 59049064
2-methylbut-3-enyl N-[5-(but-3-enoxycarbonylamino)-2-methylphenyl]carbamate (PubChem CID 59049064) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-methylbut-3-enyl N-[5-(but-3-enoxycarbonylamino)-2-methylphenyl]carbamate.
| Compound Name | 2-methylbut-3-enyl N-[5-(but-3-enoxycarbonylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 59049064 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-methylbut-3-enyl N-[5-(but-3-enoxycarbonylamino)-2-methylphenyl]carbamate |
| SMILES | C=CCCOC(=O)Nc1ccc(C)c(NC(=O)OCC(C)C=C)c1 |
| InChI | InChI=1S/C18H24N2O4/c1-5-7-10-23-17(21)19-15-9-8-14(4)16(11-15)20-18(22)24-12-13(3)6-2/h5-6,8-9,11,13H,1-2,7,10,12H2,3-4H3,(H,19,21)(H,20,22) |
| InChIKey | BRKCAJQLRMYLBV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|