C21H30N2O6 — CID 59319780
4-ethenoxybutyl N-[4-(4-ethenoxybutoxycarbonylamino)-2-methylphenyl]carbamate (PubChem CID 59319780) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is 4-ethenoxybutyl N-[4-(4-ethenoxybutoxycarbonylamino)-2-methylphenyl]carbamate.
| Compound Name | 4-ethenoxybutyl N-[4-(4-ethenoxybutoxycarbonylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 59319780 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-ethenoxybutyl N-[4-(4-ethenoxybutoxycarbonylamino)-2-methylphenyl]carbamate |
| SMILES | C=COCCCCOC(=O)Nc1ccc(NC(=O)OCCCCOC=C)c(C)c1 |
| InChI | InChI=1S/C21H30N2O6/c1-4-26-12-6-8-14-28-20(24)22-18-10-11-19(17(3)16-18)23-21(25)29-15-9-7-13-27-5-2/h4-5,10-11,16H,1-2,6-9,12-15H2,3H3,(H,22,24)(H,23,25) |
| InChIKey | BLMSCTGHNRWLQO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|