C13H16N2O4 — CID 177169834
2-[(5-amino-2-methylphenyl)carbamoyloxy]ethyl prop-2-enoate (PubChem CID 177169834) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-[(5-amino-2-methylphenyl)carbamoyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[(5-amino-2-methylphenyl)carbamoyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 177169834 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-[(5-amino-2-methylphenyl)carbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)Nc1cc(N)ccc1C |
| InChI | InChI=1S/C13H16N2O4/c1-3-12(16)18-6-7-19-13(17)15-11-8-10(14)5-4-9(11)2/h3-5,8H,1,6-7,14H2,2H3,(H,15,17) |
| InChIKey | LTRFPXWVBLULOU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|