C14H24N2O5 — CID 177169833
2-[(5-amino-2-methylphenyl)carbamoyloxy]ethyl prop-2-enoate;methanol;molecular hydrogen (PubChem CID 177169833) has the molecular formula C14H24N2O5 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-[(5-amino-2-methylphenyl)carbamoyloxy]ethyl prop-2-enoate;methanol;molecular hydrogen.
| Compound Name | 2-[(5-amino-2-methylphenyl)carbamoyloxy]ethyl prop-2-enoate;methanol;molecular hydrogen |
|---|---|
| PubChem CID | 177169833 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-[(5-amino-2-methylphenyl)carbamoyloxy]ethyl prop-2-enoate;methanol;molecular hydrogen |
| SMILES | C=CC(=O)OCCOC(=O)Nc1cc(N)ccc1C.CO.[H][H].[H][H] |
| InChI | InChI=1S/C13H16N2O4.CH4O.2H2/c1-3-12(16)18-6-7-19-13(17)15-11-8-10(14)5-4-9(11)2;1-2;;/h3-5,8H,1,6-7,14H2,2H3,(H,15,17);2H,1H3;2*1H |
| InChIKey | KXGSWHZGDIVTMS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|