C25H37N3O8 — CID 177169837
2-[[2-methyl-5-[[2-methyl-2-[4-methyl-4-(methylcarbamoyloxy)pentan-2-yl]oxypropanoyl]amino]phenyl]carbamoyloxy]ethyl prop-2-enoate (PubChem CID 177169837) has the molecular formula C25H37N3O8 and a molecular weight of 507.58 g/mol. Its IUPAC name is 2-[[2-methyl-5-[[2-methyl-2-[4-methyl-4-(methylcarbamoyloxy)pentan-2-yl]oxypropanoyl]amino]phenyl]carbamoyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[[2-methyl-5-[[2-methyl-2-[4-methyl-4-(methylcarbamoyloxy)pentan-2-yl]oxypropanoyl]amino]phenyl]carbamoyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 177169837 |
| Molecular Formula | C25H37N3O8 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 2-[[2-methyl-5-[[2-methyl-2-[4-methyl-4-(methylcarbamoyloxy)pentan-2-yl]oxypropanoyl]amino]phenyl]carbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)Nc1cc(NC(=O)C(C)(C)OC(C)CC(C)(C)OC(=O)NC)ccc1C |
| InChI | InChI=1S/C25H37N3O8/c1-9-20(29)33-12-13-34-23(32)28-19-14-18(11-10-16(19)2)27-21(30)25(6,7)35-17(3)15-24(4,5)36-22(31)26-8/h9-11,14,17H,1,12-13,15H2,2-8H3,(H,26,31)(H,27,30)(H,28,32) |
| InChIKey | YPKVCLRIEBVUCO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|