C13H13NO7 — CID 59042097
2-hydroxy-5-(2-prop-2-enoyloxyethoxycarbonylamino)benzoic acid (PubChem CID 59042097) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is 2-hydroxy-5-(2-prop-2-enoyloxyethoxycarbonylamino)benzoic acid.
| Compound Name | 2-hydroxy-5-(2-prop-2-enoyloxyethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 59042097 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-hydroxy-5-(2-prop-2-enoyloxyethoxycarbonylamino)benzoic acid |
| SMILES | C=CC(=O)OCCOC(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H13NO7/c1-2-11(16)20-5-6-21-13(19)14-8-3-4-10(15)9(7-8)12(17)18/h2-4,7,15H,1,5-6H2,(H,14,19)(H,17,18) |
| InChIKey | LSTHKMKSAFUDME-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|