C15H15NO7 — CID 139741129
5-(prop-2-enoxycarbonylamino)-2-prop-2-enoxycarbonyloxybenzoic acid (PubChem CID 139741129) has the molecular formula C15H15NO7 and a molecular weight of 321.29 g/mol. Its IUPAC name is 5-(prop-2-enoxycarbonylamino)-2-prop-2-enoxycarbonyloxybenzoic acid.
| Compound Name | 5-(prop-2-enoxycarbonylamino)-2-prop-2-enoxycarbonyloxybenzoic acid |
|---|---|
| PubChem CID | 139741129 |
| Molecular Formula | C15H15NO7 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-(prop-2-enoxycarbonylamino)-2-prop-2-enoxycarbonyloxybenzoic acid |
| SMILES | C=CCOC(=O)Nc1ccc(OC(=O)OCC=C)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H15NO7/c1-3-7-21-14(19)16-10-5-6-12(11(9-10)13(17)18)23-15(20)22-8-4-2/h3-6,9H,1-2,7-8H2,(H,16,19)(H,17,18) |
| InChIKey | AOKNTVLFZIXNAB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|