C15H19NO6 — CID 22341898
5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propanoyloxybenzoic acid (PubChem CID 22341898) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propanoyloxybenzoic acid.
| Compound Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propanoyloxybenzoic acid |
|---|---|
| PubChem CID | 22341898 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propanoyloxybenzoic acid |
| SMILES | CCC(=O)Oc1ccc(NC(=O)OC(C)(C)C)cc1C(=O)O |
| InChI | InChI=1S/C15H19NO6/c1-5-12(17)21-11-7-6-9(8-10(11)13(18)19)16-14(20)22-15(2,3)4/h6-8H,5H2,1-4H3,(H,16,20)(H,18,19) |
| InChIKey | ZBGIBCPBBVXCPI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|