C18H29NO5Si — CID 90152282
5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-triethylsilyloxybenzoic acid (PubChem CID 90152282) has the molecular formula C18H29NO5Si and a molecular weight of 367.52 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-triethylsilyloxybenzoic acid.
| Compound Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-triethylsilyloxybenzoic acid |
|---|---|
| PubChem CID | 90152282 |
| Molecular Formula | C18H29NO5Si |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-triethylsilyloxybenzoic acid |
| SMILES | CC[Si](CC)(CC)Oc1ccc(NC(=O)OC(C)(C)C)cc1C(=O)O |
| InChI | InChI=1S/C18H29NO5Si/c1-7-25(8-2,9-3)24-15-11-10-13(12-14(15)16(20)21)19-17(22)23-18(4,5)6/h10-12H,7-9H2,1-6H3,(H,19,22)(H,20,21) |
| InChIKey | DGPDPEDTQZJOIL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|