C16H15NO5 — CID 19001014
2-hydroxy-4-(2-phenylethoxycarbonylamino)benzoic acid (PubChem CID 19001014) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-hydroxy-4-(2-phenylethoxycarbonylamino)benzoic acid.
| Compound Name | 2-hydroxy-4-(2-phenylethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 19001014 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-hydroxy-4-(2-phenylethoxycarbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)c(O)c1)OCCc1ccccc1 |
| InChI | InChI=1S/C16H15NO5/c18-14-10-12(6-7-13(14)15(19)20)17-16(21)22-9-8-11-4-2-1-3-5-11/h1-7,10,18H,8-9H2,(H,17,21)(H,19,20) |
| InChIKey | WCADWENTKSICJB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |