C12H12O6 — CID 87705823
2-(2-hydroxybenzoyl)peroxyethyl prop-2-enoate (PubChem CID 87705823) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is 2-(2-hydroxybenzoyl)peroxyethyl prop-2-enoate.
| Compound Name | 2-(2-hydroxybenzoyl)peroxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 87705823 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-(2-hydroxybenzoyl)peroxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOOC(=O)c1ccccc1O |
| InChI | InChI=1S/C12H12O6/c1-2-11(14)16-7-8-17-18-12(15)9-5-3-4-6-10(9)13/h2-6,13H,1,7-8H2 |
| InChIKey | PESQGEPOIMNNSC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|