C12H11O6Zn+ — CID 22348574
zinc 2-(2-prop-2-enoyloxyethylperoxy)benzoate (PubChem CID 22348574) has the molecular formula C12H11O6Zn+ and a molecular weight of 316.60 g/mol. Its IUPAC name is zinc 2-(2-prop-2-enoyloxyethylperoxy)benzoate.
| Compound Name | zinc 2-(2-prop-2-enoyloxyethylperoxy)benzoate |
|---|---|
| PubChem CID | 22348574 |
| Molecular Formula | C12H11O6Zn+ |
| Molecular Weight | 316.60 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | zinc 2-(2-prop-2-enoyloxyethylperoxy)benzoate |
| SMILES | C=CC(=O)OCCOOc1ccccc1C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/C12H12O6.Zn/c1-2-11(13)16-7-8-17-18-10-6-4-3-5-9(10)12(14)15;/h2-6H,1,7-8H2,(H,14,15);/q;+2/p-1 |
| InChIKey | ZXRPLFFYHCJJFT-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.60 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|